Diferencia entre revisiones de «Ácido micofenólico»

1454 bytes añadidos ,  hace 2 años
sin resumen de edición
m (WPCleaner v1.41 - Check Wikipedia (Enlace a la propia página))
| Riesgo_dependencia =
| Vías_administración = Oral, [[intravenosaIV]]
}}
{{Ficha de medicamento
| nombre_medicamento = Micofenolato mofetilo
| Verifiedfields = changed
| verifiedrevid = 476999346
| Imagen = Mycophenolate mofetil2DACS.svg
| width = 250px
| Imagen2=Mycophenolate mofetil ball-and-stick.png
| IUPAC = 2-Morfolin-4-iletil (E)-6-(4-hidroxi-6-metoxi-7-metil-3-oxo-1H-2-benzofuran-5-il)-4-metilhex-4-enoato
<!--Clinical data-->
| tradename = CellCept
| Drugs.com = {{drugs.com|monograph|mycophenolate-mofetil}}
| licence_EU = CellCept
| licence_US = Mycophenolate_mofetil
| legal_status =
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|CAS}}
| Número_CAS = 128794-94-5
| Prefijo_ATC = L04
| Sufijo_ATC = AA06
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 8764
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C07908
| PubChem=5281078
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1456
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00688
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4444535
<!--Chemical data-->
| C=23 | H=31 | N=1 | O=7
| Peso_molecular=433,49474 g.mol<sup>−1</sup>
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C23H31NO7/c1-15(5-7-19(25)30-13-10-24-8-11-29-12-9-24)4-6-17-21(26)20-18(14-31-23(20)27)16(2)22(17)28-3/h4,26H,5-14H2,1-3H3/b15-4+
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = RTGDFNSFWBGLEC-SYZQJQIISA-N
| smiles=CC1=C(C(=C(C2=C1COC2=O)O)CC=C(C)CCC(=O)OCCN3CCOCC3)OC
}}
 
8457

ediciones